C19H36N4S2 — CID 54391732
4,6-bis(octylsulfanyl)-1,3,5-triazin-2-amine (PubChem CID 54391732) has the molecular formula C19H36N4S2 and a molecular weight of 384.66 g/mol. Its IUPAC name is 4,6-bis(octylsulfanyl)-1,3,5-triazin-2-amine.
| Compound Name | 4,6-bis(octylsulfanyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 54391732 |
| Molecular Formula | C19H36N4S2 |
| Molecular Weight | 384.66 g/mol |
| Exact Mass | 384.24 |
| IUPAC Name | 4,6-bis(octylsulfanyl)-1,3,5-triazin-2-amine |
| SMILES | CCCCCCCCSc1nc(N)nc(SCCCCCCCC)n1 |
| InChI | InChI=1S/C19H36N4S2/c1-3-5-7-9-11-13-15-24-18-21-17(20)22-19(23-18)25-16-14-12-10-8-6-4-2/h3-16H2,1-2H3,(H2,20,21,22,23) |
| InChIKey | VPQGDUSWZDSVLY-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.66 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|