C15H22O11S — CID 54392295
[(2S,3S,4S,5R,6S)-4,5,6-triacetyloxy-2-(methylsulfonylmethyl)oxan-3-yl] acetate (PubChem CID 54392295) has the molecular formula C15H22O11S and a molecular weight of 410.40 g/mol. Its IUPAC name is [(2S,3S,4S,5R,6S)-4,5,6-triacetyloxy-2-(methylsulfonylmethyl)oxan-3-yl] acetate.
| Compound Name | [(2S,3S,4S,5R,6S)-4,5,6-triacetyloxy-2-(methylsulfonylmethyl)oxan-3-yl] acetate |
|---|---|
| PubChem CID | 54392295 |
| Molecular Formula | C15H22O11S |
| Molecular Weight | 410.40 g/mol |
| Exact Mass | 410.09 |
| IUPAC Name | [(2S,3S,4S,5R,6S)-4,5,6-triacetyloxy-2-(methylsulfonylmethyl)oxan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1O[C@H](CS(C)(=O)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C15H22O11S/c1-7(16)22-12-11(6-27(5,20)21)26-15(25-10(4)19)14(24-9(3)18)13(12)23-8(2)17/h11-15H,6H2,1-5H3/t11-,12-,13+,14-,15-/m1/s1 |
| InChIKey | VHMLCZOSVUGZNC-UXXRCYHCSA-N |
| XLogP | -0.89 |
| TPSA | 148.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.40 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|