C22H28O8 — CID 54392777
dimethyl (E)-but-2-enedioate;dimethyl tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4,5-dicarboxylate (PubChem CID 54392777) has the molecular formula C22H28O8 and a molecular weight of 420.46 g/mol. Its IUPAC name is dimethyl (E)-but-2-enedioate;dimethyl tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4,5-dicarboxylate.
| Compound Name | dimethyl (E)-but-2-enedioate;dimethyl tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4,5-dicarboxylate |
|---|---|
| PubChem CID | 54392777 |
| Molecular Formula | C22H28O8 |
| Molecular Weight | 420.46 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | dimethyl (E)-but-2-enedioate;dimethyl tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4,5-dicarboxylate |
| SMILES | COC(=O)/C=C/C(=O)OC.COC(=O)C1C2CC(C1C(=O)OC)C1C3C=CC(C3)C21 |
| InChI | InChI=1S/C16H20O4.C6H8O4/c1-19-15(17)13-9-6-10(14(13)16(18)20-2)12-8-4-3-7(5-8)11(9)12;1-9-5(7)3-4-6(8)10-2/h3-4,7-14H,5-6H2,1-2H3;3-4H,1-2H3/b;4-3+ |
| InChIKey | VHVLPRGDAPNQIG-SCBDLNNBSA-N |
| XLogP | 1.54 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.46 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|