C17H14F3N3O3S — CID 54392816
methyl 3-methoxy-2-[6-methyl-2-[4-(trifluoromethyl)phenyl]-[1,3]thiazolo[3,2-b][1,2,4]triazol-5-yl]prop-2-enoate (PubChem CID 54392816) has the molecular formula C17H14F3N3O3S and a molecular weight of 397.38 g/mol. Its IUPAC name is methyl 3-methoxy-2-[6-methyl-2-[4-(trifluoromethyl)phenyl]-[1,3]thiazolo[3,2-b][1,2,4]triazol-5-yl]prop-2-enoate.
| Compound Name | methyl 3-methoxy-2-[6-methyl-2-[4-(trifluoromethyl)phenyl]-[1,3]thiazolo[3,2-b][1,2,4]triazol-5-yl]prop-2-enoate |
|---|---|
| PubChem CID | 54392816 |
| Molecular Formula | C17H14F3N3O3S |
| Molecular Weight | 397.38 g/mol |
| Exact Mass | 397.07 |
| IUPAC Name | methyl 3-methoxy-2-[6-methyl-2-[4-(trifluoromethyl)phenyl]-[1,3]thiazolo[3,2-b][1,2,4]triazol-5-yl]prop-2-enoate |
| SMILES | COC=C(C(=O)OC)c1sc2nc(-c3ccc(C(F)(F)F)cc3)nn2c1C |
| InChI | InChI=1S/C17H14F3N3O3S/c1-9-13(12(8-25-2)15(24)26-3)27-16-21-14(22-23(9)16)10-4-6-11(7-5-10)17(18,19)20/h4-8H,1-3H3 |
| InChIKey | VHVZMMXFEMUUHY-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 65.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.38 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|