C14H16F12O2 — CID 54392831
(7R)-3-[2,2-difluoro-1-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)ethoxy]-7-fluorooct-1-ene (PubChem CID 54392831) has the molecular formula C14H16F12O2 and a molecular weight of 444.26 g/mol. Its IUPAC name is (7R)-3-[2,2-difluoro-1-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)ethoxy]-7-fluorooct-1-ene.
| Compound Name | (7R)-3-[2,2-difluoro-1-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)ethoxy]-7-fluorooct-1-ene |
|---|---|
| PubChem CID | 54392831 |
| Molecular Formula | C14H16F12O2 |
| Molecular Weight | 444.26 g/mol |
| Exact Mass | 444.10 |
| IUPAC Name | (7R)-3-[2,2-difluoro-1-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)ethoxy]-7-fluorooct-1-ene |
| SMILES | C=CC(CCC[C@@H](C)F)OC(OC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(F)F |
| InChI | InChI=1S/C14H16F12O2/c1-3-8(6-4-5-7(2)15)27-10(9(16)17)28-14(25,26)12(20,21)11(18,19)13(22,23)24/h3,7-10H,1,4-6H2,2H3/t7-,8?,10?/m1/s1 |
| InChIKey | VHWKFFTWGLCYMM-ZNFPMYQNSA-N |
| XLogP | 6.12 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.26 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|