About 2-[(2S)-3,4-dihydro-2H-chromen-2-yl]ethanol
2-[(2S)-3,4-dihydro-2H-chromen-2-yl]ethanol (PubChem CID 54393265) has the molecular formula C11H14O2
and a molecular weight of 178.23 g/mol. Its IUPAC name is 2-[(2S)-3,4-dihydro-2H-chromen-2-yl]ethanol.
Molecular Properties
| Compound Name | 2-[(2S)-3,4-dihydro-2H-chromen-2-yl]ethanol |
| PubChem CID | 54393265 |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | 2-[(2S)-3,4-dihydro-2H-chromen-2-yl]ethanol |
| SMILES | OCC[C@@H]1CCc2ccccc2O1 |
| InChI | InChI=1S/C11H14O2/c12-8-7-10-6-5-9-3-1-2-4-11(9)13-10/h1-4,10,12H,5-8H2/t10-/m0/s1 |
| InChIKey | VIDWVCCCBOXZME-JTQLQIEISA-N |
| XLogP | 1.76 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[(2S)-3,4-dihydro-2H-chromen-2-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2S)-3,4-dihydro-2H-chromen-2-yl]ethanol?
The IUPAC name of 2-[(2S)-3,4-dihydro-2H-chromen-2-yl]ethanol (CID 54393265) is 2-[(2S)-3,4-dihydro-2H-chromen-2-yl]ethanol.
What is the SMILES notation for 2-[(2S)-3,4-dihydro-2H-chromen-2-yl]ethanol?
The canonical SMILES for 2-[(2S)-3,4-dihydro-2H-chromen-2-yl]ethanol is OCC[C@@H]1CCc2ccccc2O1.
What is the InChIKey of 2-[(2S)-3,4-dihydro-2H-chromen-2-yl]ethanol?
The InChIKey is VIDWVCCCBOXZME-JTQLQIEISA-N. The full InChI is InChI=1S/C11H14O2/c12-8-7-10-6-5-9-3-1-2-4-11(9)13-10/h1-4,10,12H,5-8H2/t10-/m0/s1.
What are the key properties of 2-[(2S)-3,4-dihydro-2H-chromen-2-yl]ethanol?
2-[(2S)-3,4-dihydro-2H-chromen-2-yl]ethanol has a molecular weight of 178.23 g/mol, XLogP of 1.76, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2S)-3,4-dihydro-2H-chromen-2-yl]ethanol is sourced from PubChem (CID 54393265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).