C21H32F12N2O3 — CID 54393529
1-(3-ethoxy-1,1,2,2,3,3-hexafluoropropyl)-4-methylpiperidine;4-(1,1,2,2,3,3-hexafluoro-3-methoxypropyl)-2,6-dimethylmorpholine (PubChem CID 54393529) has the molecular formula C21H32F12N2O3 and a molecular weight of 588.47 g/mol. Its IUPAC name is 1-(3-ethoxy-1,1,2,2,3,3-hexafluoropropyl)-4-methylpiperidine;4-(1,1,2,2,3,3-hexafluoro-3-methoxypropyl)-2,6-dimethylmorpholine.
| Compound Name | 1-(3-ethoxy-1,1,2,2,3,3-hexafluoropropyl)-4-methylpiperidine;4-(1,1,2,2,3,3-hexafluoro-3-methoxypropyl)-2,6-dimethylmorpholine |
|---|---|
| PubChem CID | 54393529 |
| Molecular Formula | C21H32F12N2O3 |
| Molecular Weight | 588.47 g/mol |
| Exact Mass | 588.22 |
| IUPAC Name | 1-(3-ethoxy-1,1,2,2,3,3-hexafluoropropyl)-4-methylpiperidine;4-(1,1,2,2,3,3-hexafluoro-3-methoxypropyl)-2,6-dimethylmorpholine |
| SMILES | CCOC(F)(F)C(F)(F)C(F)(F)N1CCC(C)CC1.COC(F)(F)C(F)(F)C(F)(F)N1CC(C)OC(C)C1 |
| InChI | InChI=1S/C11H17F6NO.C10H15F6NO2/c1-3-19-11(16,17)9(12,13)10(14,15)18-6-4-8(2)5-7-18;1-6-4-17(5-7(2)19-6)9(13,14)8(11,12)10(15,16)18-3/h8H,3-7H2,1-2H3;6-7H,4-5H2,1-3H3 |
| InChIKey | VIIHINGCYKIALB-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 34.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.47 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|