C25H37F3O6S — CID 54393624
7-[3,5-dihydroxy-2-[3-methylsulfonyl-5-[4-(trifluoromethyl)phenyl]pentyl]cyclopentyl]heptanoic acid (PubChem CID 54393624) has the molecular formula C25H37F3O6S and a molecular weight of 522.63 g/mol. Its IUPAC name is 7-[3,5-dihydroxy-2-[3-methylsulfonyl-5-[4-(trifluoromethyl)phenyl]pentyl]cyclopentyl]heptanoic acid.
| Compound Name | 7-[3,5-dihydroxy-2-[3-methylsulfonyl-5-[4-(trifluoromethyl)phenyl]pentyl]cyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 54393624 |
| Molecular Formula | C25H37F3O6S |
| Molecular Weight | 522.63 g/mol |
| Exact Mass | 522.23 |
| IUPAC Name | 7-[3,5-dihydroxy-2-[3-methylsulfonyl-5-[4-(trifluoromethyl)phenyl]pentyl]cyclopentyl]heptanoic acid |
| SMILES | CS(=O)(=O)C(CCc1ccc(C(F)(F)F)cc1)CCC1C(O)CC(O)C1CCCCCCC(=O)O |
| InChI | InChI=1S/C25H37F3O6S/c1-35(33,34)19(13-10-17-8-11-18(12-9-17)25(26,27)28)14-15-21-20(22(29)16-23(21)30)6-4-2-3-5-7-24(31)32/h8-9,11-12,19-23,29-30H,2-7,10,13-16H2,1H3,(H,31,32) |
| InChIKey | VIJRXXVESBSXHU-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.63 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|