C19H34O — CID 54394043
2-methyl-2-prop-1-enyl-3,4,4a,5,6,7,8,9,10,11,12,13,14,14a-tetradecahydrocyclododeca[b]pyran (PubChem CID 54394043) has the molecular formula C19H34O and a molecular weight of 278.48 g/mol. Its IUPAC name is 2-methyl-2-prop-1-enyl-3,4,4a,5,6,7,8,9,10,11,12,13,14,14a-tetradecahydrocyclododeca[b]pyran.
| Compound Name | 2-methyl-2-prop-1-enyl-3,4,4a,5,6,7,8,9,10,11,12,13,14,14a-tetradecahydrocyclododeca[b]pyran |
|---|---|
| PubChem CID | 54394043 |
| Molecular Formula | C19H34O |
| Molecular Weight | 278.48 g/mol |
| Exact Mass | 278.26 |
| IUPAC Name | 2-methyl-2-prop-1-enyl-3,4,4a,5,6,7,8,9,10,11,12,13,14,14a-tetradecahydrocyclododeca[b]pyran |
| SMILES | CC=CC1(C)CCC2CCCCCCCCCCC2O1 |
| InChI | InChI=1S/C19H34O/c1-3-15-19(2)16-14-17-12-10-8-6-4-5-7-9-11-13-18(17)20-19/h3,15,17-18H,4-14,16H2,1-2H3 |
| InChIKey | VIRFOTAXPMLBTP-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.48 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|