C27H34N4O8S — CID 54394089
N-[1-[[(3S)-3-hydroxy-1-(1-oxidopyridin-1-ium-2-yl)sulfonylazepan-4-yl]amino]-4-methyl-1-oxopentan-2-yl]-5-methoxy-1-benzofuran-2-carboxamide (PubChem CID 54394089) has the molecular formula C27H34N4O8S and a molecular weight of 574.66 g/mol. Its IUPAC name is N-[1-[[(3S)-3-hydroxy-1-(1-oxidopyridin-1-ium-2-yl)sulfonylazepan-4-yl]amino]-4-methyl-1-oxopentan-2-yl]-5-methoxy-1-benzofuran-2-carboxamide.
| Compound Name | N-[1-[[(3S)-3-hydroxy-1-(1-oxidopyridin-1-ium-2-yl)sulfonylazepan-4-yl]amino]-4-methyl-1-oxopentan-2-yl]-5-methoxy-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 54394089 |
| Molecular Formula | C27H34N4O8S |
| Molecular Weight | 574.66 g/mol |
| Exact Mass | 574.21 |
| IUPAC Name | N-[1-[[(3S)-3-hydroxy-1-(1-oxidopyridin-1-ium-2-yl)sulfonylazepan-4-yl]amino]-4-methyl-1-oxopentan-2-yl]-5-methoxy-1-benzofuran-2-carboxamide |
| SMILES | COc1ccc2oc(C(=O)NC(CC(C)C)C(=O)NC3CCCN(S(=O)(=O)c4cccc[n+]4[O-])C[C@@H]3O)cc2c1 |
| InChI | InChI=1S/C27H34N4O8S/c1-17(2)13-21(29-27(34)24-15-18-14-19(38-3)9-10-23(18)39-24)26(33)28-20-7-6-11-30(16-22(20)32)40(36,37)25-8-4-5-12-31(25)35/h4-5,8-10,12,14-15,17,20-22,32H,6-7,11,13,16H2,1-3H3,(H,28,33)(H,29,34)/t20?,21?,22-/m0/s1 |
| InChIKey | VIRZWLCOOQUMDY-HRTMPFAESA-N |
| XLogP | 1.55 |
| TPSA | 165.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.66 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|