About 2-sulfanylidene-1,3-thiazolidine-3-carboxylic acid
2-sulfanylidene-1,3-thiazolidine-3-carboxylic acid (PubChem CID 54394217) has the molecular formula C4H5NO2S2
and a molecular weight of 163.22 g/mol. Its IUPAC name is 2-sulfanylidene-1,3-thiazolidine-3-carboxylic acid.
Molecular Properties
| Compound Name | 2-sulfanylidene-1,3-thiazolidine-3-carboxylic acid |
| PubChem CID | 54394217 |
| Molecular Formula | C4H5NO2S2 |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 162.98 |
| IUPAC Name | 2-sulfanylidene-1,3-thiazolidine-3-carboxylic acid |
| SMILES | O=C(O)N1CCSC1=S |
| InChI | InChI=1S/C4H5NO2S2/c6-3(7)5-1-2-9-4(5)8/h1-2H2,(H,6,7) |
| InChIKey | VIUFJYVWICFMKU-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-sulfanylidene-1,3-thiazolidine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-sulfanylidene-1,3-thiazolidine-3-carboxylic acid?
The IUPAC name of 2-sulfanylidene-1,3-thiazolidine-3-carboxylic acid (CID 54394217) is 2-sulfanylidene-1,3-thiazolidine-3-carboxylic acid.
What is the SMILES notation for 2-sulfanylidene-1,3-thiazolidine-3-carboxylic acid?
The canonical SMILES for 2-sulfanylidene-1,3-thiazolidine-3-carboxylic acid is O=C(O)N1CCSC1=S.
What is the InChIKey of 2-sulfanylidene-1,3-thiazolidine-3-carboxylic acid?
The InChIKey is VIUFJYVWICFMKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5NO2S2/c6-3(7)5-1-2-9-4(5)8/h1-2H2,(H,6,7).
What are the key properties of 2-sulfanylidene-1,3-thiazolidine-3-carboxylic acid?
2-sulfanylidene-1,3-thiazolidine-3-carboxylic acid has a molecular weight of 163.22 g/mol, XLogP of 1.00, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-sulfanylidene-1,3-thiazolidine-3-carboxylic acid is sourced from PubChem (CID 54394217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).