C9H10O2 — CID 54394606
5,6,8,8a-tetrahydrochromen-7-one (PubChem CID 54394606) has the molecular formula C9H10O2 and a molecular weight of 150.18 g/mol. Its IUPAC name is 5,6,8,8a-tetrahydrochromen-7-one.
| Compound Name | 5,6,8,8a-tetrahydrochromen-7-one |
|---|---|
| PubChem CID | 54394606 |
| Molecular Formula | C9H10O2 |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.07 |
| IUPAC Name | 5,6,8,8a-tetrahydrochromen-7-one |
| SMILES | O=C1CCC2=CC=COC2C1 |
| InChI | InChI=1S/C9H10O2/c10-8-4-3-7-2-1-5-11-9(7)6-8/h1-2,5,9H,3-4,6H2 |
| InChIKey | JSIVFRHGISXLIL-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |