About 2-[2-(2-phenylethylsulfanyl)ethyl]-1,2,4-benzothiadiazine
2-[2-(2-phenylethylsulfanyl)ethyl]-1,2,4-benzothiadiazine (PubChem CID 54394759) has the molecular formula C17H18N2S2
and a molecular weight of 314.48 g/mol. Its IUPAC name is 2-[2-(2-phenylethylsulfanyl)ethyl]-1,2,4-benzothiadiazine.
Molecular Properties
| Compound Name | 2-[2-(2-phenylethylsulfanyl)ethyl]-1,2,4-benzothiadiazine |
| PubChem CID | 54394759 |
| Molecular Formula | C17H18N2S2 |
| Molecular Weight | 314.48 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | 2-[2-(2-phenylethylsulfanyl)ethyl]-1,2,4-benzothiadiazine |
| SMILES | C1=Nc2ccccc2SN1CCSCCc1ccccc1 |
| InChI | InChI=1S/C17H18N2S2/c1-2-6-15(7-3-1)10-12-20-13-11-19-14-18-16-8-4-5-9-17(16)21-19/h1-9,14H,10-13H2 |
| InChIKey | VJDPZJGGZNSSQK-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.48 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(2-phenylethylsulfanyl)ethyl]-1,2,4-benzothiadiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(2-phenylethylsulfanyl)ethyl]-1,2,4-benzothiadiazine?
The IUPAC name of 2-[2-(2-phenylethylsulfanyl)ethyl]-1,2,4-benzothiadiazine (CID 54394759) is 2-[2-(2-phenylethylsulfanyl)ethyl]-1,2,4-benzothiadiazine.
What is the SMILES notation for 2-[2-(2-phenylethylsulfanyl)ethyl]-1,2,4-benzothiadiazine?
The canonical SMILES for 2-[2-(2-phenylethylsulfanyl)ethyl]-1,2,4-benzothiadiazine is C1=Nc2ccccc2SN1CCSCCc1ccccc1.
What is the InChIKey of 2-[2-(2-phenylethylsulfanyl)ethyl]-1,2,4-benzothiadiazine?
The InChIKey is VJDPZJGGZNSSQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18N2S2/c1-2-6-15(7-3-1)10-12-20-13-11-19-14-18-16-8-4-5-9-17(16)21-19/h1-9,14H,10-13H2.
What are the key properties of 2-[2-(2-phenylethylsulfanyl)ethyl]-1,2,4-benzothiadiazine?
2-[2-(2-phenylethylsulfanyl)ethyl]-1,2,4-benzothiadiazine has a molecular weight of 314.48 g/mol, XLogP of 4.64, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2-phenylethylsulfanyl)ethyl]-1,2,4-benzothiadiazine is sourced from PubChem (CID 54394759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).