C44H12F20N4 — CID 54394837
5,10,15,20-tetrakis(2,3,4,5,6-pentafluorophenyl)-21,22,23,24-tetrahydroporphyrin (PubChem CID 54394837) has the molecular formula C44H12F20N4 and a molecular weight of 976.57 g/mol. Its IUPAC name is 5,10,15,20-tetrakis(2,3,4,5,6-pentafluorophenyl)-21,22,23,24-tetrahydroporphyrin.
| Compound Name | 5,10,15,20-tetrakis(2,3,4,5,6-pentafluorophenyl)-21,22,23,24-tetrahydroporphyrin |
|---|---|
| PubChem CID | 54394837 |
| Molecular Formula | C44H12F20N4 |
| Molecular Weight | 976.57 g/mol |
| Exact Mass | 976.07 |
| IUPAC Name | 5,10,15,20-tetrakis(2,3,4,5,6-pentafluorophenyl)-21,22,23,24-tetrahydroporphyrin |
| SMILES | Fc1c(F)c(F)c(C2=c3ccc([nH]3)=C(c3c(F)c(F)c(F)c(F)c3F)c3ccc([nH]3)C(c3c(F)c(F)c(F)c(F)c3F)=c3ccc([nH]3)=C(c3c(F)c(F)c(F)c(F)c3F)c3ccc2[nH]3)c(F)c1F |
| InChI | InChI=1S/C44H12F20N4/c45-25-21(26(46)34(54)41(61)33(25)53)17-9-1-2-10(65-9)18(22-27(47)35(55)42(62)36(56)28(22)48)12-5-6-14(67-12)20(24-31(51)39(59)44(64)40(60)32(24)52)16-8-7-15(68-16)19(13-4-3-11(17)66-13)23-29(49)37(57)43(63)38(58)30(23)50/h1-8,65-68H |
| InChIKey | WHEOVJCQXXXEFK-UHFFFAOYSA-N |
| XLogP | 9.08 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 976.57 |
| LogP ≤ 5 | 9.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|