About (4S,5R)-3-fluoro-5-(hydroxymethyl)thiolane-2,4-diol
(4S,5R)-3-fluoro-5-(hydroxymethyl)thiolane-2,4-diol (PubChem CID 54395377) has the molecular formula C5H9FO3S
and a molecular weight of 168.19 g/mol. Its IUPAC name is (4S,5R)-3-fluoro-5-(hydroxymethyl)thiolane-2,4-diol.
Molecular Properties
| Compound Name | (4S,5R)-3-fluoro-5-(hydroxymethyl)thiolane-2,4-diol |
| PubChem CID | 54395377 |
| Molecular Formula | C5H9FO3S |
| Molecular Weight | 168.19 g/mol |
| Exact Mass | 168.03 |
| IUPAC Name | (4S,5R)-3-fluoro-5-(hydroxymethyl)thiolane-2,4-diol |
| SMILES | OC[C@H]1SC(O)C(F)[C@@H]1O |
| InChI | InChI=1S/C5H9FO3S/c6-3-4(8)2(1-7)10-5(3)9/h2-5,7-9H,1H2/t2-,3?,4-,5?/m1/s1 |
| InChIKey | VJOJBWXANVDCFD-WRIDMXSSSA-N |
| XLogP | -0.89 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.19 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4S,5R)-3-fluoro-5-(hydroxymethyl)thiolane-2,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S,5R)-3-fluoro-5-(hydroxymethyl)thiolane-2,4-diol?
The IUPAC name of (4S,5R)-3-fluoro-5-(hydroxymethyl)thiolane-2,4-diol (CID 54395377) is (4S,5R)-3-fluoro-5-(hydroxymethyl)thiolane-2,4-diol.
What is the SMILES notation for (4S,5R)-3-fluoro-5-(hydroxymethyl)thiolane-2,4-diol?
The canonical SMILES for (4S,5R)-3-fluoro-5-(hydroxymethyl)thiolane-2,4-diol is OC[C@H]1SC(O)C(F)[C@@H]1O.
What is the InChIKey of (4S,5R)-3-fluoro-5-(hydroxymethyl)thiolane-2,4-diol?
The InChIKey is VJOJBWXANVDCFD-WRIDMXSSSA-N. The full InChI is InChI=1S/C5H9FO3S/c6-3-4(8)2(1-7)10-5(3)9/h2-5,7-9H,1H2/t2-,3?,4-,5?/m1/s1.
What are the key properties of (4S,5R)-3-fluoro-5-(hydroxymethyl)thiolane-2,4-diol?
(4S,5R)-3-fluoro-5-(hydroxymethyl)thiolane-2,4-diol has a molecular weight of 168.19 g/mol, XLogP of -0.89, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4S,5R)-3-fluoro-5-(hydroxymethyl)thiolane-2,4-diol is sourced from PubChem (CID 54395377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).