About 1-[1-chloro-4-[2-(3,4-difluorophenyl)ethyl]cyclohexyl]-1-phenylsilinane
1-[1-chloro-4-[2-(3,4-difluorophenyl)ethyl]cyclohexyl]-1-phenylsilinane (PubChem CID 54395493) has the molecular formula C25H31ClF2Si
and a molecular weight of 433.06 g/mol. Its IUPAC name is 1-[1-chloro-4-[2-(3,4-difluorophenyl)ethyl]cyclohexyl]-1-phenylsilinane.
Molecular Properties
| Compound Name | 1-[1-chloro-4-[2-(3,4-difluorophenyl)ethyl]cyclohexyl]-1-phenylsilinane |
| PubChem CID | 54395493 |
| Molecular Formula | C25H31ClF2Si |
| Molecular Weight | 433.06 g/mol |
| Exact Mass | 432.19 |
| IUPAC Name | 1-[1-chloro-4-[2-(3,4-difluorophenyl)ethyl]cyclohexyl]-1-phenylsilinane |
| SMILES | Fc1ccc(CCC2CCC(Cl)([Si]3(c4ccccc4)CCCCC3)CC2)cc1F |
| InChI | InChI=1S/C25H31ClF2Si/c26-25(29(17-5-2-6-18-29)22-7-3-1-4-8-22)15-13-20(14-16-25)9-10-21-11-12-23(27)24(28)19-21/h1,3-4,7-8,11-12,19-20H,2,5-6,9-10,13-18H2 |
| InChIKey | VJQBBRDTWDLZIZ-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 433.06 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-[1-chloro-4-[2-(3,4-difluorophenyl)ethyl]cyclohexyl]-1-phenylsilinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-chloro-4-[2-(3,4-difluorophenyl)ethyl]cyclohexyl]-1-phenylsilinane?
The IUPAC name of 1-[1-chloro-4-[2-(3,4-difluorophenyl)ethyl]cyclohexyl]-1-phenylsilinane (CID 54395493) is 1-[1-chloro-4-[2-(3,4-difluorophenyl)ethyl]cyclohexyl]-1-phenylsilinane.
What is the SMILES notation for 1-[1-chloro-4-[2-(3,4-difluorophenyl)ethyl]cyclohexyl]-1-phenylsilinane?
The canonical SMILES for 1-[1-chloro-4-[2-(3,4-difluorophenyl)ethyl]cyclohexyl]-1-phenylsilinane is Fc1ccc(CCC2CCC(Cl)([Si]3(c4ccccc4)CCCCC3)CC2)cc1F.
What is the InChIKey of 1-[1-chloro-4-[2-(3,4-difluorophenyl)ethyl]cyclohexyl]-1-phenylsilinane?
The InChIKey is VJQBBRDTWDLZIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H31ClF2Si/c26-25(29(17-5-2-6-18-29)22-7-3-1-4-8-22)15-13-20(14-16-25)9-10-21-11-12-23(27)24(28)19-21/h1,3-4,7-8,11-12,19-20H,2,5-6,9-10,13-18H2.
What are the key properties of 1-[1-chloro-4-[2-(3,4-difluorophenyl)ethyl]cyclohexyl]-1-phenylsilinane?
1-[1-chloro-4-[2-(3,4-difluorophenyl)ethyl]cyclohexyl]-1-phenylsilinane has a molecular weight of 433.06 g/mol, XLogP of 7.14, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-chloro-4-[2-(3,4-difluorophenyl)ethyl]cyclohexyl]-1-phenylsilinane is sourced from PubChem (CID 54395493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).