About methyl 2-[4-morpholin-4-yl-2-(2,2,2-trifluoroethoxy)phenyl]acetate
methyl 2-[4-morpholin-4-yl-2-(2,2,2-trifluoroethoxy)phenyl]acetate (PubChem CID 54395758) has the molecular formula C15H18F3NO4
and a molecular weight of 333.31 g/mol. Its IUPAC name is methyl 2-[4-morpholin-4-yl-2-(2,2,2-trifluoroethoxy)phenyl]acetate.
Molecular Properties
| Compound Name | methyl 2-[4-morpholin-4-yl-2-(2,2,2-trifluoroethoxy)phenyl]acetate |
| PubChem CID | 54395758 |
| Molecular Formula | C15H18F3NO4 |
| Molecular Weight | 333.31 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | methyl 2-[4-morpholin-4-yl-2-(2,2,2-trifluoroethoxy)phenyl]acetate |
| SMILES | COC(=O)Cc1ccc(N2CCOCC2)cc1OCC(F)(F)F |
| InChI | InChI=1S/C15H18F3NO4/c1-21-14(20)8-11-2-3-12(19-4-6-22-7-5-19)9-13(11)23-10-15(16,17)18/h2-3,9H,4-8,10H2,1H3 |
| InChIKey | VJUUNDMOZAKOEK-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.31 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 2-[4-morpholin-4-yl-2-(2,2,2-trifluoroethoxy)phenyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[4-morpholin-4-yl-2-(2,2,2-trifluoroethoxy)phenyl]acetate?
The IUPAC name of methyl 2-[4-morpholin-4-yl-2-(2,2,2-trifluoroethoxy)phenyl]acetate (CID 54395758) is methyl 2-[4-morpholin-4-yl-2-(2,2,2-trifluoroethoxy)phenyl]acetate.
What is the SMILES notation for methyl 2-[4-morpholin-4-yl-2-(2,2,2-trifluoroethoxy)phenyl]acetate?
The canonical SMILES for methyl 2-[4-morpholin-4-yl-2-(2,2,2-trifluoroethoxy)phenyl]acetate is COC(=O)Cc1ccc(N2CCOCC2)cc1OCC(F)(F)F.
What is the InChIKey of methyl 2-[4-morpholin-4-yl-2-(2,2,2-trifluoroethoxy)phenyl]acetate?
The InChIKey is VJUUNDMOZAKOEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18F3NO4/c1-21-14(20)8-11-2-3-12(19-4-6-22-7-5-19)9-13(11)23-10-15(16,17)18/h2-3,9H,4-8,10H2,1H3.
What are the key properties of methyl 2-[4-morpholin-4-yl-2-(2,2,2-trifluoroethoxy)phenyl]acetate?
methyl 2-[4-morpholin-4-yl-2-(2,2,2-trifluoroethoxy)phenyl]acetate has a molecular weight of 333.31 g/mol, XLogP of 2.18, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[4-morpholin-4-yl-2-(2,2,2-trifluoroethoxy)phenyl]acetate is sourced from PubChem (CID 54395758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).