About pyridin-2-yl nitrate
pyridin-2-yl nitrate (PubChem CID 54396083) has the molecular formula C5H4N2O3
and a molecular weight of 140.10 g/mol. Its IUPAC name is pyridin-2-yl nitrate.
Molecular Properties
| Compound Name | pyridin-2-yl nitrate |
| PubChem CID | 54396083 |
| Molecular Formula | C5H4N2O3 |
| Molecular Weight | 140.10 g/mol |
| Exact Mass | 140.02 |
| IUPAC Name | pyridin-2-yl nitrate |
| SMILES | O=[N+]([O-])Oc1ccccn1 |
| InChI | InChI=1S/C5H4N2O3/c8-7(9)10-5-3-1-2-4-6-5/h1-4H |
| InChIKey | VKAUJKYXPJELEV-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 65.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.10 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze pyridin-2-yl nitrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridin-2-yl nitrate?
The IUPAC name of pyridin-2-yl nitrate (CID 54396083) is pyridin-2-yl nitrate.
What is the SMILES notation for pyridin-2-yl nitrate?
The canonical SMILES for pyridin-2-yl nitrate is O=[N+]([O-])Oc1ccccn1.
What is the InChIKey of pyridin-2-yl nitrate?
The InChIKey is VKAUJKYXPJELEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4N2O3/c8-7(9)10-5-3-1-2-4-6-5/h1-4H.
What are the key properties of pyridin-2-yl nitrate?
pyridin-2-yl nitrate has a molecular weight of 140.10 g/mol, XLogP of 0.65, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for pyridin-2-yl nitrate is sourced from PubChem (CID 54396083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).