About 1-cyclohexyl-4-(5,5,5-trifluoro-4-propoxypent-1-enyl)cyclohexane
1-cyclohexyl-4-(5,5,5-trifluoro-4-propoxypent-1-enyl)cyclohexane (PubChem CID 54396473) has the molecular formula C20H33F3O
and a molecular weight of 346.48 g/mol. Its IUPAC name is 1-cyclohexyl-4-(5,5,5-trifluoro-4-propoxypent-1-enyl)cyclohexane.
Molecular Properties
| Compound Name | 1-cyclohexyl-4-(5,5,5-trifluoro-4-propoxypent-1-enyl)cyclohexane |
| PubChem CID | 54396473 |
| Molecular Formula | C20H33F3O |
| Molecular Weight | 346.48 g/mol |
| Exact Mass | 346.25 |
| IUPAC Name | 1-cyclohexyl-4-(5,5,5-trifluoro-4-propoxypent-1-enyl)cyclohexane |
| SMILES | CCCOC(CC=CC1CCC(C2CCCCC2)CC1)C(F)(F)F |
| InChI | InChI=1S/C20H33F3O/c1-2-15-24-19(20(21,22)23)10-6-7-16-11-13-18(14-12-16)17-8-4-3-5-9-17/h6-7,16-19H,2-5,8-15H2,1H3 |
| InChIKey | VKHXSKFVSBKBPB-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 346.48 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclohexyl-4-(5,5,5-trifluoro-4-propoxypent-1-enyl)cyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexyl-4-(5,5,5-trifluoro-4-propoxypent-1-enyl)cyclohexane?
The IUPAC name of 1-cyclohexyl-4-(5,5,5-trifluoro-4-propoxypent-1-enyl)cyclohexane (CID 54396473) is 1-cyclohexyl-4-(5,5,5-trifluoro-4-propoxypent-1-enyl)cyclohexane.
What is the SMILES notation for 1-cyclohexyl-4-(5,5,5-trifluoro-4-propoxypent-1-enyl)cyclohexane?
The canonical SMILES for 1-cyclohexyl-4-(5,5,5-trifluoro-4-propoxypent-1-enyl)cyclohexane is CCCOC(CC=CC1CCC(C2CCCCC2)CC1)C(F)(F)F.
What is the InChIKey of 1-cyclohexyl-4-(5,5,5-trifluoro-4-propoxypent-1-enyl)cyclohexane?
The InChIKey is VKHXSKFVSBKBPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H33F3O/c1-2-15-24-19(20(21,22)23)10-6-7-16-11-13-18(14-12-16)17-8-4-3-5-9-17/h6-7,16-19H,2-5,8-15H2,1H3.
What are the key properties of 1-cyclohexyl-4-(5,5,5-trifluoro-4-propoxypent-1-enyl)cyclohexane?
1-cyclohexyl-4-(5,5,5-trifluoro-4-propoxypent-1-enyl)cyclohexane has a molecular weight of 346.48 g/mol, XLogP of 6.68, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexyl-4-(5,5,5-trifluoro-4-propoxypent-1-enyl)cyclohexane is sourced from PubChem (CID 54396473), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).