About 12-methoxycyclododeca-4,8-dien-1-one
12-methoxycyclododeca-4,8-dien-1-one (PubChem CID 54397025) has the molecular formula C13H20O2
and a molecular weight of 208.30 g/mol. Its IUPAC name is 12-methoxycyclododeca-4,8-dien-1-one.
Molecular Properties
| Compound Name | 12-methoxycyclododeca-4,8-dien-1-one |
| PubChem CID | 54397025 |
| Molecular Formula | C13H20O2 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.15 |
| IUPAC Name | 12-methoxycyclododeca-4,8-dien-1-one |
| SMILES | COC1CCC=CCCC=CCCC1=O |
| InChI | InChI=1S/C13H20O2/c1-15-13-11-9-7-5-3-2-4-6-8-10-12(13)14/h4-7,13H,2-3,8-11H2,1H3 |
| InChIKey | VKSCEVBPLMYFTA-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 12-methoxycyclododeca-4,8-dien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 12-methoxycyclododeca-4,8-dien-1-one?
The IUPAC name of 12-methoxycyclododeca-4,8-dien-1-one (CID 54397025) is 12-methoxycyclododeca-4,8-dien-1-one.
What is the SMILES notation for 12-methoxycyclododeca-4,8-dien-1-one?
The canonical SMILES for 12-methoxycyclododeca-4,8-dien-1-one is COC1CCC=CCCC=CCCC1=O.
What is the InChIKey of 12-methoxycyclododeca-4,8-dien-1-one?
The InChIKey is VKSCEVBPLMYFTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20O2/c1-15-13-11-9-7-5-3-2-4-6-8-10-12(13)14/h4-7,13H,2-3,8-11H2,1H3.
What are the key properties of 12-methoxycyclododeca-4,8-dien-1-one?
12-methoxycyclododeca-4,8-dien-1-one has a molecular weight of 208.30 g/mol, XLogP of 3.04, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 12-methoxycyclododeca-4,8-dien-1-one is sourced from PubChem (CID 54397025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).