About 3-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-amine
3-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-amine (PubChem CID 54397061) has the molecular formula C9H13NS
and a molecular weight of 167.28 g/mol. Its IUPAC name is 3-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-amine.
Analyze 3-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-amine?
The IUPAC name of 3-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-amine (CID 54397061) is 3-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-amine.
What is the SMILES notation for 3-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-amine?
The canonical SMILES for 3-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-amine is Cc1c(N)sc2c1CCCC2.
What is the InChIKey of 3-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-amine?
The InChIKey is VKSSAYDRUIZCST-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NS/c1-6-7-4-2-3-5-8(7)11-9(6)10/h2-5,10H2,1H3.
What are the key properties of 3-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-amine?
3-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-amine has a molecular weight of 167.28 g/mol, XLogP of 2.52, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-amine is sourced from PubChem (CID 54397061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).