About oct-7-enoic acid
oct-7-enoic acid (PubChem CID 543977) has the molecular formula C8H14O2
and a molecular weight of 142.20 g/mol. Its IUPAC name is oct-7-enoic acid.
Molecular Properties
| Compound Name | oct-7-enoic acid |
| PubChem CID | 543977 |
| Molecular Formula | C8H14O2 |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.10 |
| IUPAC Name | oct-7-enoic acid |
| SMILES | C=CCCCCCC(=O)O |
| InChI | InChI=1S/C8H14O2/c1-2-3-4-5-6-7-8(9)10/h2H,1,3-7H2,(H,9,10) |
| InChIKey | OZYYQTRHHXLTKX-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze oct-7-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oct-7-enoic acid?
The IUPAC name of oct-7-enoic acid (CID 543977) is oct-7-enoic acid.
What is the SMILES notation for oct-7-enoic acid?
The canonical SMILES for oct-7-enoic acid is C=CCCCCCC(=O)O.
What is the InChIKey of oct-7-enoic acid?
The InChIKey is OZYYQTRHHXLTKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O2/c1-2-3-4-5-6-7-8(9)10/h2H,1,3-7H2,(H,9,10).
What are the key properties of oct-7-enoic acid?
oct-7-enoic acid has a molecular weight of 142.20 g/mol, XLogP of 2.21, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for oct-7-enoic acid is sourced from PubChem (CID 543977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).