About 9H-fluoren-9-ylmethyl 2,2,2-trifluoroacetate
9H-fluoren-9-ylmethyl 2,2,2-trifluoroacetate (PubChem CID 54397890) has the molecular formula C16H11F3O2
and a molecular weight of 292.26 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl 2,2,2-trifluoroacetate.
Molecular Properties
| Compound Name | 9H-fluoren-9-ylmethyl 2,2,2-trifluoroacetate |
| PubChem CID | 54397890 |
| Molecular Formula | C16H11F3O2 |
| Molecular Weight | 292.26 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | 9H-fluoren-9-ylmethyl 2,2,2-trifluoroacetate |
| SMILES | O=C(OCC1c2ccccc2-c2ccccc21)C(F)(F)F |
| InChI | InChI=1S/C16H11F3O2/c17-16(18,19)15(20)21-9-14-12-7-3-1-5-10(12)11-6-2-4-8-13(11)14/h1-8,14H,9H2 |
| InChIKey | VLIAHQXPCPCYQU-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.26 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 9H-fluoren-9-ylmethyl 2,2,2-trifluoroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9H-fluoren-9-ylmethyl 2,2,2-trifluoroacetate?
The IUPAC name of 9H-fluoren-9-ylmethyl 2,2,2-trifluoroacetate (CID 54397890) is 9H-fluoren-9-ylmethyl 2,2,2-trifluoroacetate.
What is the SMILES notation for 9H-fluoren-9-ylmethyl 2,2,2-trifluoroacetate?
The canonical SMILES for 9H-fluoren-9-ylmethyl 2,2,2-trifluoroacetate is O=C(OCC1c2ccccc2-c2ccccc21)C(F)(F)F.
What is the InChIKey of 9H-fluoren-9-ylmethyl 2,2,2-trifluoroacetate?
The InChIKey is VLIAHQXPCPCYQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11F3O2/c17-16(18,19)15(20)21-9-14-12-7-3-1-5-10(12)11-6-2-4-8-13(11)14/h1-8,14H,9H2.
What are the key properties of 9H-fluoren-9-ylmethyl 2,2,2-trifluoroacetate?
9H-fluoren-9-ylmethyl 2,2,2-trifluoroacetate has a molecular weight of 292.26 g/mol, XLogP of 3.90, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9H-fluoren-9-ylmethyl 2,2,2-trifluoroacetate is sourced from PubChem (CID 54397890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).