C6H10OS — CID 54398136
2,3-dimethyl-2,3-dihydrothiophene 1-oxide (PubChem CID 54398136) has the molecular formula C6H10OS and a molecular weight of 130.21 g/mol. Its IUPAC name is 2,3-dimethyl-2,3-dihydrothiophene 1-oxide.
| Compound Name | 2,3-dimethyl-2,3-dihydrothiophene 1-oxide |
|---|---|
| PubChem CID | 54398136 |
| Molecular Formula | C6H10OS |
| Molecular Weight | 130.21 g/mol |
| Exact Mass | 130.05 |
| IUPAC Name | 2,3-dimethyl-2,3-dihydrothiophene 1-oxide |
| SMILES | CC1C=CS(=O)C1C |
| InChI | InChI=1S/C6H10OS/c1-5-3-4-8(7)6(5)2/h3-6H,1-2H3 |
| InChIKey | BGWIVWLBLAFJPE-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.21 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |