C11H14NO5P — CID 54398449
(2S,4S)-4-(phosphonomethyl)-1,2,3,4-tetrahydroquinoline-2-carboxylic acid (PubChem CID 54398449) has the molecular formula C11H14NO5P and a molecular weight of 271.21 g/mol. Its IUPAC name is (2S,4S)-4-(phosphonomethyl)-1,2,3,4-tetrahydroquinoline-2-carboxylic acid.
| Compound Name | (2S,4S)-4-(phosphonomethyl)-1,2,3,4-tetrahydroquinoline-2-carboxylic acid |
|---|---|
| PubChem CID | 54398449 |
| Molecular Formula | C11H14NO5P |
| Molecular Weight | 271.21 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | (2S,4S)-4-(phosphonomethyl)-1,2,3,4-tetrahydroquinoline-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1C[C@H](CP(=O)(O)O)c2ccccc2N1 |
| InChI | InChI=1S/C11H14NO5P/c13-11(14)10-5-7(6-18(15,16)17)8-3-1-2-4-9(8)12-10/h1-4,7,10,12H,5-6H2,(H,13,14)(H2,15,16,17)/t7-,10+/m1/s1 |
| InChIKey | VLRPFYXFLFOGEK-XCBNKYQSSA-N |
| XLogP | 1.22 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.21 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|