C14H27IO2 — CID 54398761
3-(1-ethoxyethoxy)-1-iodo-4,4-dimethyloct-1-ene (PubChem CID 54398761) has the molecular formula C14H27IO2 and a molecular weight of 354.27 g/mol. Its IUPAC name is 3-(1-ethoxyethoxy)-1-iodo-4,4-dimethyloct-1-ene.
| Compound Name | 3-(1-ethoxyethoxy)-1-iodo-4,4-dimethyloct-1-ene |
|---|---|
| PubChem CID | 54398761 |
| Molecular Formula | C14H27IO2 |
| Molecular Weight | 354.27 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | 3-(1-ethoxyethoxy)-1-iodo-4,4-dimethyloct-1-ene |
| SMILES | CCCCC(C)(C)C(C=CI)OC(C)OCC |
| InChI | InChI=1S/C14H27IO2/c1-6-8-10-14(4,5)13(9-11-15)17-12(3)16-7-2/h9,11-13H,6-8,10H2,1-5H3 |
| InChIKey | VLWYVFUNKXBTSP-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.27 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|