About 2,2-dibenzyloxolane
2,2-dibenzyloxolane (PubChem CID 54399574) has the molecular formula C18H20O
and a molecular weight of 252.36 g/mol. Its IUPAC name is 2,2-dibenzyloxolane.
Molecular Properties
| Compound Name | 2,2-dibenzyloxolane |
| PubChem CID | 54399574 |
| Molecular Formula | C18H20O |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | 2,2-dibenzyloxolane |
| SMILES | c1ccc(CC2(Cc3ccccc3)CCCO2)cc1 |
| InChI | InChI=1S/C18H20O/c1-3-8-16(9-4-1)14-18(12-7-13-19-18)15-17-10-5-2-6-11-17/h1-6,8-11H,7,12-15H2 |
| InChIKey | VMLFIYNRSDPHMZ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,2-dibenzyloxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dibenzyloxolane?
The IUPAC name of 2,2-dibenzyloxolane (CID 54399574) is 2,2-dibenzyloxolane.
What is the SMILES notation for 2,2-dibenzyloxolane?
The canonical SMILES for 2,2-dibenzyloxolane is c1ccc(CC2(Cc3ccccc3)CCCO2)cc1.
What is the InChIKey of 2,2-dibenzyloxolane?
The InChIKey is VMLFIYNRSDPHMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20O/c1-3-8-16(9-4-1)14-18(12-7-13-19-18)15-17-10-5-2-6-11-17/h1-6,8-11H,7,12-15H2.
What are the key properties of 2,2-dibenzyloxolane?
2,2-dibenzyloxolane has a molecular weight of 252.36 g/mol, XLogP of 4.02, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dibenzyloxolane is sourced from PubChem (CID 54399574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).