About N-(4,5-dihydro-1H-imidazol-2-ylmethyl)acetamide
N-(4,5-dihydro-1H-imidazol-2-ylmethyl)acetamide (PubChem CID 54399781) has the molecular formula C6H11N3O
and a molecular weight of 141.17 g/mol. Its IUPAC name is N-(4,5-dihydro-1H-imidazol-2-ylmethyl)acetamide.
Molecular Properties
| Compound Name | N-(4,5-dihydro-1H-imidazol-2-ylmethyl)acetamide |
| PubChem CID | 54399781 |
| Molecular Formula | C6H11N3O |
| Molecular Weight | 141.17 g/mol |
| Exact Mass | 141.09 |
| IUPAC Name | N-(4,5-dihydro-1H-imidazol-2-ylmethyl)acetamide |
| SMILES | CC(=O)NCC1=NCCN1 |
| InChI | InChI=1S/C6H11N3O/c1-5(10)9-4-6-7-2-3-8-6/h2-4H2,1H3,(H,7,8)(H,9,10) |
| InChIKey | ZSLJRDXBZPQBHV-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.17 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(4,5-dihydro-1H-imidazol-2-ylmethyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4,5-dihydro-1H-imidazol-2-ylmethyl)acetamide?
The IUPAC name of N-(4,5-dihydro-1H-imidazol-2-ylmethyl)acetamide (CID 54399781) is N-(4,5-dihydro-1H-imidazol-2-ylmethyl)acetamide.
What is the SMILES notation for N-(4,5-dihydro-1H-imidazol-2-ylmethyl)acetamide?
The canonical SMILES for N-(4,5-dihydro-1H-imidazol-2-ylmethyl)acetamide is CC(=O)NCC1=NCCN1.
What is the InChIKey of N-(4,5-dihydro-1H-imidazol-2-ylmethyl)acetamide?
The InChIKey is ZSLJRDXBZPQBHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N3O/c1-5(10)9-4-6-7-2-3-8-6/h2-4H2,1H3,(H,7,8)(H,9,10).
What are the key properties of N-(4,5-dihydro-1H-imidazol-2-ylmethyl)acetamide?
N-(4,5-dihydro-1H-imidazol-2-ylmethyl)acetamide has a molecular weight of 141.17 g/mol, XLogP of -0.88, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4,5-dihydro-1H-imidazol-2-ylmethyl)acetamide is sourced from PubChem (CID 54399781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).