C25H30FNO2 — CID 54399787
tert-butyl (3aR,4R,7aR)-4-fluoro-7,7-diphenyl-3,3a,4,5,6,7a-hexahydro-1H-isoindole-2-carboxylate (PubChem CID 54399787) has the molecular formula C25H30FNO2 and a molecular weight of 395.52 g/mol. Its IUPAC name is tert-butyl (3aR,4R,7aR)-4-fluoro-7,7-diphenyl-3,3a,4,5,6,7a-hexahydro-1H-isoindole-2-carboxylate.
| Compound Name | tert-butyl (3aR,4R,7aR)-4-fluoro-7,7-diphenyl-3,3a,4,5,6,7a-hexahydro-1H-isoindole-2-carboxylate |
|---|---|
| PubChem CID | 54399787 |
| Molecular Formula | C25H30FNO2 |
| Molecular Weight | 395.52 g/mol |
| Exact Mass | 395.23 |
| IUPAC Name | tert-butyl (3aR,4R,7aR)-4-fluoro-7,7-diphenyl-3,3a,4,5,6,7a-hexahydro-1H-isoindole-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H]2[C@H](F)CCC(c3ccccc3)(c3ccccc3)[C@@H]2C1 |
| InChI | InChI=1S/C25H30FNO2/c1-24(2,3)29-23(28)27-16-20-21(17-27)25(15-14-22(20)26,18-10-6-4-7-11-18)19-12-8-5-9-13-19/h4-13,20-22H,14-17H2,1-3H3/t20-,21+,22+/m0/s1 |
| InChIKey | VMOVDDAZVSSFIT-BHDDXSALSA-N |
| XLogP | 5.59 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.52 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |