About [2-(4-fluorobenzoyl)-3,6-diphenylphenyl]-(4-fluorophenyl)methanone
[2-(4-fluorobenzoyl)-3,6-diphenylphenyl]-(4-fluorophenyl)methanone (PubChem CID 54400181) has the molecular formula C32H20F2O2
and a molecular weight of 474.51 g/mol. Its IUPAC name is [2-(4-fluorobenzoyl)-3,6-diphenylphenyl]-(4-fluorophenyl)methanone.
Molecular Properties
| Compound Name | [2-(4-fluorobenzoyl)-3,6-diphenylphenyl]-(4-fluorophenyl)methanone |
| PubChem CID | 54400181 |
| Molecular Formula | C32H20F2O2 |
| Molecular Weight | 474.51 g/mol |
| Exact Mass | 474.14 |
| IUPAC Name | [2-(4-fluorobenzoyl)-3,6-diphenylphenyl]-(4-fluorophenyl)methanone |
| SMILES | O=C(c1ccc(F)cc1)c1c(-c2ccccc2)ccc(-c2ccccc2)c1C(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C32H20F2O2/c33-25-15-11-23(12-16-25)31(35)29-27(21-7-3-1-4-8-21)19-20-28(22-9-5-2-6-10-22)30(29)32(36)24-13-17-26(34)18-14-24/h1-20H |
| InChIKey | VMVZERRZGNZKGL-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 474.51 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [2-(4-fluorobenzoyl)-3,6-diphenylphenyl]-(4-fluorophenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(4-fluorobenzoyl)-3,6-diphenylphenyl]-(4-fluorophenyl)methanone?
The IUPAC name of [2-(4-fluorobenzoyl)-3,6-diphenylphenyl]-(4-fluorophenyl)methanone (CID 54400181) is [2-(4-fluorobenzoyl)-3,6-diphenylphenyl]-(4-fluorophenyl)methanone.
What is the SMILES notation for [2-(4-fluorobenzoyl)-3,6-diphenylphenyl]-(4-fluorophenyl)methanone?
The canonical SMILES for [2-(4-fluorobenzoyl)-3,6-diphenylphenyl]-(4-fluorophenyl)methanone is O=C(c1ccc(F)cc1)c1c(-c2ccccc2)ccc(-c2ccccc2)c1C(=O)c1ccc(F)cc1.
What is the InChIKey of [2-(4-fluorobenzoyl)-3,6-diphenylphenyl]-(4-fluorophenyl)methanone?
The InChIKey is VMVZERRZGNZKGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H20F2O2/c33-25-15-11-23(12-16-25)31(35)29-27(21-7-3-1-4-8-21)19-20-28(22-9-5-2-6-10-22)30(29)32(36)24-13-17-26(34)18-14-24/h1-20H.
What are the key properties of [2-(4-fluorobenzoyl)-3,6-diphenylphenyl]-(4-fluorophenyl)methanone?
[2-(4-fluorobenzoyl)-3,6-diphenylphenyl]-(4-fluorophenyl)methanone has a molecular weight of 474.51 g/mol, XLogP of 7.76, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(4-fluorobenzoyl)-3,6-diphenylphenyl]-(4-fluorophenyl)methanone is sourced from PubChem (CID 54400181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).