About 4-amino-N,5-dibromo-1-methylpyrazole-3-carboxamide
4-amino-N,5-dibromo-1-methylpyrazole-3-carboxamide (PubChem CID 54400652) has the molecular formula C5H6Br2N4O
and a molecular weight of 297.94 g/mol. Its IUPAC name is 4-amino-N,5-dibromo-1-methylpyrazole-3-carboxamide.
Molecular Properties
| Compound Name | 4-amino-N,5-dibromo-1-methylpyrazole-3-carboxamide |
| PubChem CID | 54400652 |
| Molecular Formula | C5H6Br2N4O |
| Molecular Weight | 297.94 g/mol |
| Exact Mass | 295.89 |
| IUPAC Name | 4-amino-N,5-dibromo-1-methylpyrazole-3-carboxamide |
| SMILES | Cn1nc(C(=O)NBr)c(N)c1Br |
| InChI | InChI=1S/C5H6Br2N4O/c1-11-4(6)2(8)3(10-11)5(12)9-7/h8H2,1H3,(H,9,12) |
| InChIKey | VNEQVBQEUYXQAQ-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.94 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-N,5-dibromo-1-methylpyrazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-N,5-dibromo-1-methylpyrazole-3-carboxamide?
The IUPAC name of 4-amino-N,5-dibromo-1-methylpyrazole-3-carboxamide (CID 54400652) is 4-amino-N,5-dibromo-1-methylpyrazole-3-carboxamide.
What is the SMILES notation for 4-amino-N,5-dibromo-1-methylpyrazole-3-carboxamide?
The canonical SMILES for 4-amino-N,5-dibromo-1-methylpyrazole-3-carboxamide is Cn1nc(C(=O)NBr)c(N)c1Br.
What is the InChIKey of 4-amino-N,5-dibromo-1-methylpyrazole-3-carboxamide?
The InChIKey is VNEQVBQEUYXQAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6Br2N4O/c1-11-4(6)2(8)3(10-11)5(12)9-7/h8H2,1H3,(H,9,12).
What are the key properties of 4-amino-N,5-dibromo-1-methylpyrazole-3-carboxamide?
4-amino-N,5-dibromo-1-methylpyrazole-3-carboxamide has a molecular weight of 297.94 g/mol, XLogP of 0.80, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-N,5-dibromo-1-methylpyrazole-3-carboxamide is sourced from PubChem (CID 54400652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).