C7H16N2 — CID 54400744
1-N,1-N'-dimethylpent-2-ene-1,1-diamine (PubChem CID 54400744) has the molecular formula C7H16N2 and a molecular weight of 128.22 g/mol. Its IUPAC name is 1-N,1-N'-dimethylpent-2-ene-1,1-diamine.
| Compound Name | 1-N,1-N'-dimethylpent-2-ene-1,1-diamine |
|---|---|
| PubChem CID | 54400744 |
| Molecular Formula | C7H16N2 |
| Molecular Weight | 128.22 g/mol |
| Exact Mass | 128.13 |
| IUPAC Name | 1-N,1-N'-dimethylpent-2-ene-1,1-diamine |
| SMILES | CCC=CC(NC)NC |
| InChI | InChI=1S/C7H16N2/c1-4-5-6-7(8-2)9-3/h5-9H,4H2,1-3H3 |
| InChIKey | VNGIJNORWACOMM-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.22 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|