C23H20N2O — CID 54400884
1-(2,4,5-triphenyl-2,4-dihydroimidazol-3-yl)ethanone (PubChem CID 54400884) has the molecular formula C23H20N2O and a molecular weight of 340.43 g/mol. Its IUPAC name is 1-(2,4,5-triphenyl-2,4-dihydroimidazol-3-yl)ethanone.
| Compound Name | 1-(2,4,5-triphenyl-2,4-dihydroimidazol-3-yl)ethanone |
|---|---|
| PubChem CID | 54400884 |
| Molecular Formula | C23H20N2O |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | 1-(2,4,5-triphenyl-2,4-dihydroimidazol-3-yl)ethanone |
| SMILES | CC(=O)N1C(c2ccccc2)N=C(c2ccccc2)C1c1ccccc1 |
| InChI | InChI=1S/C23H20N2O/c1-17(26)25-22(19-13-7-3-8-14-19)21(18-11-5-2-6-12-18)24-23(25)20-15-9-4-10-16-20/h2-16,22-23H,1H3 |
| InChIKey | VNIMUJACBKKBRG-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |