About 10-hydroxy-3-methyl-8-propyl-2,4-dihydro-1H-chromeno[3,4-c]pyridin-5-one
10-hydroxy-3-methyl-8-propyl-2,4-dihydro-1H-chromeno[3,4-c]pyridin-5-one (PubChem CID 5440108) has the molecular formula C16H19NO3
and a molecular weight of 273.33 g/mol. Its IUPAC name is 10-hydroxy-3-methyl-8-propyl-2,4-dihydro-1H-chromeno[3,4-c]pyridin-5-one.
Molecular Properties
| Compound Name | 10-hydroxy-3-methyl-8-propyl-2,4-dihydro-1H-chromeno[3,4-c]pyridin-5-one |
| PubChem CID | 5440108 |
| Molecular Formula | C16H19NO3 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | 10-hydroxy-3-methyl-8-propyl-2,4-dihydro-1H-chromeno[3,4-c]pyridin-5-one |
| SMILES | CCCc1cc(O)c2c3c(c(=O)oc2c1)CN(C)CC3 |
| InChI | InChI=1S/C16H19NO3/c1-3-4-10-7-13(18)15-11-5-6-17(2)9-12(11)16(19)20-14(15)8-10/h7-8,18H,3-6,9H2,1-2H3 |
| InChIKey | JYZGRMRMVUUYHG-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 53.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 10-hydroxy-3-methyl-8-propyl-2,4-dihydro-1H-chromeno[3,4-c]pyridin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-hydroxy-3-methyl-8-propyl-2,4-dihydro-1H-chromeno[3,4-c]pyridin-5-one?
The IUPAC name of 10-hydroxy-3-methyl-8-propyl-2,4-dihydro-1H-chromeno[3,4-c]pyridin-5-one (CID 5440108) is 10-hydroxy-3-methyl-8-propyl-2,4-dihydro-1H-chromeno[3,4-c]pyridin-5-one.
What is the SMILES notation for 10-hydroxy-3-methyl-8-propyl-2,4-dihydro-1H-chromeno[3,4-c]pyridin-5-one?
The canonical SMILES for 10-hydroxy-3-methyl-8-propyl-2,4-dihydro-1H-chromeno[3,4-c]pyridin-5-one is CCCc1cc(O)c2c3c(c(=O)oc2c1)CN(C)CC3.
What is the InChIKey of 10-hydroxy-3-methyl-8-propyl-2,4-dihydro-1H-chromeno[3,4-c]pyridin-5-one?
The InChIKey is JYZGRMRMVUUYHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19NO3/c1-3-4-10-7-13(18)15-11-5-6-17(2)9-12(11)16(19)20-14(15)8-10/h7-8,18H,3-6,9H2,1-2H3.
What are the key properties of 10-hydroxy-3-methyl-8-propyl-2,4-dihydro-1H-chromeno[3,4-c]pyridin-5-one?
10-hydroxy-3-methyl-8-propyl-2,4-dihydro-1H-chromeno[3,4-c]pyridin-5-one has a molecular weight of 273.33 g/mol, XLogP of 2.44, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 10-hydroxy-3-methyl-8-propyl-2,4-dihydro-1H-chromeno[3,4-c]pyridin-5-one is sourced from PubChem (CID 5440108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).