About 4-[1,2-bis(dimethylamino)ethyl]-1,4-benzothiazin-3-one
4-[1,2-bis(dimethylamino)ethyl]-1,4-benzothiazin-3-one (PubChem CID 54401086) has the molecular formula C14H21N3OS
and a molecular weight of 279.41 g/mol. Its IUPAC name is 4-[1,2-bis(dimethylamino)ethyl]-1,4-benzothiazin-3-one.
Molecular Properties
| Compound Name | 4-[1,2-bis(dimethylamino)ethyl]-1,4-benzothiazin-3-one |
| PubChem CID | 54401086 |
| Molecular Formula | C14H21N3OS |
| Molecular Weight | 279.41 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | 4-[1,2-bis(dimethylamino)ethyl]-1,4-benzothiazin-3-one |
| SMILES | CN(C)CC(N(C)C)N1C(=O)CSc2ccccc21 |
| InChI | InChI=1S/C14H21N3OS/c1-15(2)9-13(16(3)4)17-11-7-5-6-8-12(11)19-10-14(17)18/h5-8,13H,9-10H2,1-4H3 |
| InChIKey | VNLXFCDXJUCPNM-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.41 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[1,2-bis(dimethylamino)ethyl]-1,4-benzothiazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1,2-bis(dimethylamino)ethyl]-1,4-benzothiazin-3-one?
The IUPAC name of 4-[1,2-bis(dimethylamino)ethyl]-1,4-benzothiazin-3-one (CID 54401086) is 4-[1,2-bis(dimethylamino)ethyl]-1,4-benzothiazin-3-one.
What is the SMILES notation for 4-[1,2-bis(dimethylamino)ethyl]-1,4-benzothiazin-3-one?
The canonical SMILES for 4-[1,2-bis(dimethylamino)ethyl]-1,4-benzothiazin-3-one is CN(C)CC(N(C)C)N1C(=O)CSc2ccccc21.
What is the InChIKey of 4-[1,2-bis(dimethylamino)ethyl]-1,4-benzothiazin-3-one?
The InChIKey is VNLXFCDXJUCPNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21N3OS/c1-15(2)9-13(16(3)4)17-11-7-5-6-8-12(11)19-10-14(17)18/h5-8,13H,9-10H2,1-4H3.
What are the key properties of 4-[1,2-bis(dimethylamino)ethyl]-1,4-benzothiazin-3-one?
4-[1,2-bis(dimethylamino)ethyl]-1,4-benzothiazin-3-one has a molecular weight of 279.41 g/mol, XLogP of 1.57, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1,2-bis(dimethylamino)ethyl]-1,4-benzothiazin-3-one is sourced from PubChem (CID 54401086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).