C12H7Cl2F3N2OS — CID 54401209
3-[(2,3-dichlorophenyl)methyl]-2-sulfanylidene-6-(trifluoromethyl)-1H-pyrimidin-4-one (PubChem CID 54401209) has the molecular formula C12H7Cl2F3N2OS and a molecular weight of 355.17 g/mol. Its IUPAC name is 3-[(2,3-dichlorophenyl)methyl]-2-sulfanylidene-6-(trifluoromethyl)-1H-pyrimidin-4-one.
| Compound Name | 3-[(2,3-dichlorophenyl)methyl]-2-sulfanylidene-6-(trifluoromethyl)-1H-pyrimidin-4-one |
|---|---|
| PubChem CID | 54401209 |
| Molecular Formula | C12H7Cl2F3N2OS |
| Molecular Weight | 355.17 g/mol |
| Exact Mass | 353.96 |
| IUPAC Name | 3-[(2,3-dichlorophenyl)methyl]-2-sulfanylidene-6-(trifluoromethyl)-1H-pyrimidin-4-one |
| SMILES | O=c1cc(C(F)(F)F)[nH]c(=S)n1Cc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C12H7Cl2F3N2OS/c13-7-3-1-2-6(10(7)14)5-19-9(20)4-8(12(15,16)17)18-11(19)21/h1-4H,5H2,(H,18,21) |
| InChIKey | VNNYKCYIDCYSJV-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 37.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.17 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|