C22H25BrN2O2 — CID 54401525
N-[[1-[[(3S)-6-bromo-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]piperidin-4-yl]methyl]-1-phenylmethanimine (PubChem CID 54401525) has the molecular formula C22H25BrN2O2 and a molecular weight of 429.36 g/mol. Its IUPAC name is N-[[1-[[(3S)-6-bromo-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]piperidin-4-yl]methyl]-1-phenylmethanimine.
| Compound Name | N-[[1-[[(3S)-6-bromo-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]piperidin-4-yl]methyl]-1-phenylmethanimine |
|---|---|
| PubChem CID | 54401525 |
| Molecular Formula | C22H25BrN2O2 |
| Molecular Weight | 429.36 g/mol |
| Exact Mass | 428.11 |
| IUPAC Name | N-[[1-[[(3S)-6-bromo-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]piperidin-4-yl]methyl]-1-phenylmethanimine |
| SMILES | Brc1ccc2c(c1)O[C@@H](CN1CCC(C/N=C/c3ccccc3)CC1)CO2 |
| InChI | InChI=1S/C22H25BrN2O2/c23-19-6-7-21-22(12-19)27-20(16-26-21)15-25-10-8-18(9-11-25)14-24-13-17-4-2-1-3-5-17/h1-7,12-13,18,20H,8-11,14-16H2/b24-13+/t20-/m0/s1 |
| InChIKey | VNTOIHANISVADB-AFEQLLIESA-N |
| XLogP | 4.42 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.36 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|