About 6-chloro-2,4-dimethyl-5-phenyl-2,3-dihydro-1H-quinoxaline
6-chloro-2,4-dimethyl-5-phenyl-2,3-dihydro-1H-quinoxaline (PubChem CID 54401907) has the molecular formula C16H17ClN2
and a molecular weight of 272.78 g/mol. Its IUPAC name is 6-chloro-2,4-dimethyl-5-phenyl-2,3-dihydro-1H-quinoxaline.
Molecular Properties
| Compound Name | 6-chloro-2,4-dimethyl-5-phenyl-2,3-dihydro-1H-quinoxaline |
| PubChem CID | 54401907 |
| Molecular Formula | C16H17ClN2 |
| Molecular Weight | 272.78 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | 6-chloro-2,4-dimethyl-5-phenyl-2,3-dihydro-1H-quinoxaline |
| SMILES | CC1CN(C)c2c(ccc(Cl)c2-c2ccccc2)N1 |
| InChI | InChI=1S/C16H17ClN2/c1-11-10-19(2)16-14(18-11)9-8-13(17)15(16)12-6-4-3-5-7-12/h3-9,11,18H,10H2,1-2H3 |
| InChIKey | VNZYFLWQAYRSSJ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.78 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-chloro-2,4-dimethyl-5-phenyl-2,3-dihydro-1H-quinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-2,4-dimethyl-5-phenyl-2,3-dihydro-1H-quinoxaline?
The IUPAC name of 6-chloro-2,4-dimethyl-5-phenyl-2,3-dihydro-1H-quinoxaline (CID 54401907) is 6-chloro-2,4-dimethyl-5-phenyl-2,3-dihydro-1H-quinoxaline.
What is the SMILES notation for 6-chloro-2,4-dimethyl-5-phenyl-2,3-dihydro-1H-quinoxaline?
The canonical SMILES for 6-chloro-2,4-dimethyl-5-phenyl-2,3-dihydro-1H-quinoxaline is CC1CN(C)c2c(ccc(Cl)c2-c2ccccc2)N1.
What is the InChIKey of 6-chloro-2,4-dimethyl-5-phenyl-2,3-dihydro-1H-quinoxaline?
The InChIKey is VNZYFLWQAYRSSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17ClN2/c1-11-10-19(2)16-14(18-11)9-8-13(17)15(16)12-6-4-3-5-7-12/h3-9,11,18H,10H2,1-2H3.
What are the key properties of 6-chloro-2,4-dimethyl-5-phenyl-2,3-dihydro-1H-quinoxaline?
6-chloro-2,4-dimethyl-5-phenyl-2,3-dihydro-1H-quinoxaline has a molecular weight of 272.78 g/mol, XLogP of 4.26, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-2,4-dimethyl-5-phenyl-2,3-dihydro-1H-quinoxaline is sourced from PubChem (CID 54401907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).