C31H34O2 — CID 54402823
2-[(8R,9R,10S,13S,14S,17R)-13-methyl-1,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]ethynyl naphthalene-2-carboxylate (PubChem CID 54402823) has the molecular formula C31H34O2 and a molecular weight of 438.61 g/mol. Its IUPAC name is 2-[(8R,9R,10S,13S,14S,17R)-13-methyl-1,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]ethynyl naphthalene-2-carboxylate.
| Compound Name | 2-[(8R,9R,10S,13S,14S,17R)-13-methyl-1,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]ethynyl naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 54402823 |
| Molecular Formula | C31H34O2 |
| Molecular Weight | 438.61 g/mol |
| Exact Mass | 438.26 |
| IUPAC Name | 2-[(8R,9R,10S,13S,14S,17R)-13-methyl-1,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]ethynyl naphthalene-2-carboxylate |
| SMILES | C[C@]12CC[C@H]3[C@@H](CCC4CC=CC[C@@H]43)[C@@H]1CC[C@H]2C#COC(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C31H34O2/c1-31-18-16-27-26-9-5-4-7-22(26)12-14-28(27)29(31)15-13-25(31)17-19-33-30(32)24-11-10-21-6-2-3-8-23(21)20-24/h2-6,8,10-11,20,22,25-29H,7,9,12-16,18H2,1H3/t22?,25-,26-,27+,28+,29-,31+/m0/s1 |
| InChIKey | VOQCVJNBWKIBRB-KZBUGNPZSA-N |
| XLogP | 7.39 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.61 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|