C18H17NO6 — CID 54403362
4-[2-(2-carboxyethenyl)phenyl]-2,6-dimethyl-3,4-dihydropyridine-3,5-dicarboxylic acid (PubChem CID 54403362) has the molecular formula C18H17NO6 and a molecular weight of 343.34 g/mol. Its IUPAC name is 4-[2-(2-carboxyethenyl)phenyl]-2,6-dimethyl-3,4-dihydropyridine-3,5-dicarboxylic acid.
| Compound Name | 4-[2-(2-carboxyethenyl)phenyl]-2,6-dimethyl-3,4-dihydropyridine-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 54403362 |
| Molecular Formula | C18H17NO6 |
| Molecular Weight | 343.34 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | 4-[2-(2-carboxyethenyl)phenyl]-2,6-dimethyl-3,4-dihydropyridine-3,5-dicarboxylic acid |
| SMILES | CC1=NC(C)=C(C(=O)O)C(c2ccccc2C=CC(=O)O)C1C(=O)O |
| InChI | InChI=1S/C18H17NO6/c1-9-14(17(22)23)16(15(18(24)25)10(2)19-9)12-6-4-3-5-11(12)7-8-13(20)21/h3-8,14,16H,1-2H3,(H,20,21)(H,22,23)(H,24,25) |
| InChIKey | VOZPTLXXLKEGAE-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 124.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.34 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|