C17H28O3 — CID 54403812
2,7-dimethyl-10-(oxan-2-yloxy)deca-1,3,7-trien-5-ol (PubChem CID 54403812) has the molecular formula C17H28O3 and a molecular weight of 280.41 g/mol. Its IUPAC name is 2,7-dimethyl-10-(oxan-2-yloxy)deca-1,3,7-trien-5-ol.
| Compound Name | 2,7-dimethyl-10-(oxan-2-yloxy)deca-1,3,7-trien-5-ol |
|---|---|
| PubChem CID | 54403812 |
| Molecular Formula | C17H28O3 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | 2,7-dimethyl-10-(oxan-2-yloxy)deca-1,3,7-trien-5-ol |
| SMILES | C=C(C)C=CC(O)CC(C)=CCCOC1CCCCO1 |
| InChI | InChI=1S/C17H28O3/c1-14(2)9-10-16(18)13-15(3)7-6-12-20-17-8-4-5-11-19-17/h7,9-10,16-18H,1,4-6,8,11-13H2,2-3H3 |
| InChIKey | VPGJCCOUQYKFDW-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|