C11H20O5Si — CID 54403876
5,5-diethyl-2-trimethylsilyloxy-1,3-dioxane-4,6-dione (PubChem CID 54403876) has the molecular formula C11H20O5Si and a molecular weight of 260.36 g/mol. Its IUPAC name is 5,5-diethyl-2-trimethylsilyloxy-1,3-dioxane-4,6-dione.
| Compound Name | 5,5-diethyl-2-trimethylsilyloxy-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 54403876 |
| Molecular Formula | C11H20O5Si |
| Molecular Weight | 260.36 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | 5,5-diethyl-2-trimethylsilyloxy-1,3-dioxane-4,6-dione |
| SMILES | CCC1(CC)C(=O)OC(O[Si](C)(C)C)OC1=O |
| InChI | InChI=1S/C11H20O5Si/c1-6-11(7-2)8(12)14-10(15-9(11)13)16-17(3,4)5/h10H,6-7H2,1-5H3 |
| InChIKey | VPHRTRJMAQHRNB-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.36 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|