C22H26O6S2 — CID 54403918
(4S,6S)-2,4,6,7-tetrahydroxy-4-methylsulfanyl-8-(4-methylsulfanylphenyl)-1-phenyloctane-3,5-dione (PubChem CID 54403918) has the molecular formula C22H26O6S2 and a molecular weight of 450.58 g/mol. Its IUPAC name is (4S,6S)-2,4,6,7-tetrahydroxy-4-methylsulfanyl-8-(4-methylsulfanylphenyl)-1-phenyloctane-3,5-dione.
| Compound Name | (4S,6S)-2,4,6,7-tetrahydroxy-4-methylsulfanyl-8-(4-methylsulfanylphenyl)-1-phenyloctane-3,5-dione |
|---|---|
| PubChem CID | 54403918 |
| Molecular Formula | C22H26O6S2 |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | (4S,6S)-2,4,6,7-tetrahydroxy-4-methylsulfanyl-8-(4-methylsulfanylphenyl)-1-phenyloctane-3,5-dione |
| SMILES | CSc1ccc(CC(O)[C@H](O)C(=O)[C@@](O)(SC)C(=O)C(O)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C22H26O6S2/c1-29-16-10-8-15(9-11-16)12-17(23)19(25)21(27)22(28,30-2)20(26)18(24)13-14-6-4-3-5-7-14/h3-11,17-19,23-25,28H,12-13H2,1-2H3/t17?,18?,19-,22-/m0/s1 |
| InChIKey | VPIOJHMHTXDQFU-VLMZZQAOSA-N |
| XLogP | 1.47 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|