C30H35N3O8 — CID 54403926
[(1R,16S)-15-cyano-13-(hydroxymethyl)-21-methoxy-22-(methoxymethoxy)-6,20,24-trimethyl-8,10-dioxa-14,24-diazahexacyclo[14.7.1.02,14.04,12.07,11.018,23]tetracosa-4,6,11,18(23),19,21-hexaen-5-yl] acetate (PubChem CID 54403926) has the molecular formula C30H35N3O8 and a molecular weight of 565.62 g/mol. Its IUPAC name is [(1R,16S)-15-cyano-13-(hydroxymethyl)-21-methoxy-22-(methoxymethoxy)-6,20,24-trimethyl-8,10-dioxa-14,24-diazahexacyclo[14.7.1.02,14.04,12.07,11.018,23]tetracosa-4,6,11,18(23),19,21-hexaen-5-yl] acetate.
| Compound Name | [(1R,16S)-15-cyano-13-(hydroxymethyl)-21-methoxy-22-(methoxymethoxy)-6,20,24-trimethyl-8,10-dioxa-14,24-diazahexacyclo[14.7.1.02,14.04,12.07,11.018,23]tetracosa-4,6,11,18(23),19,21-hexaen-5-yl] acetate |
|---|---|
| PubChem CID | 54403926 |
| Molecular Formula | C30H35N3O8 |
| Molecular Weight | 565.62 g/mol |
| Exact Mass | 565.24 |
| IUPAC Name | [(1R,16S)-15-cyano-13-(hydroxymethyl)-21-methoxy-22-(methoxymethoxy)-6,20,24-trimethyl-8,10-dioxa-14,24-diazahexacyclo[14.7.1.02,14.04,12.07,11.018,23]tetracosa-4,6,11,18(23),19,21-hexaen-5-yl] acetate |
| SMILES | COCOc1c(OC)c(C)cc2c1[C@@H]1C3Cc4c(OC(C)=O)c(C)c5c(c4C(CO)N3C(C#N)[C@H](C2)N1C)OCO5 |
| InChI | InChI=1S/C30H35N3O8/c1-14-7-17-8-19-21(10-31)33-20(25(32(19)4)23(17)29(26(14)37-6)38-12-36-5)9-18-24(22(33)11-34)30-28(39-13-40-30)15(2)27(18)41-16(3)35/h7,19-22,25,34H,8-9,11-13H2,1-6H3/t19-,20?,21?,22?,25-/m0/s1 |
| InChIKey | VPIRGTJFYSTRGV-YWXJPMLYSA-N |
| XLogP | 2.71 |
| TPSA | 122.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.62 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|