C15H12F4N4O — CID 54404012
ethyl N-[4-cyano-1-(4-ethyl-2,3,5,6-tetrafluorophenyl)pyrazol-5-yl]methanimidate (PubChem CID 54404012) has the molecular formula C15H12F4N4O and a molecular weight of 340.28 g/mol. Its IUPAC name is ethyl N-[4-cyano-1-(4-ethyl-2,3,5,6-tetrafluorophenyl)pyrazol-5-yl]methanimidate.
| Compound Name | ethyl N-[4-cyano-1-(4-ethyl-2,3,5,6-tetrafluorophenyl)pyrazol-5-yl]methanimidate |
|---|---|
| PubChem CID | 54404012 |
| Molecular Formula | C15H12F4N4O |
| Molecular Weight | 340.28 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | ethyl N-[4-cyano-1-(4-ethyl-2,3,5,6-tetrafluorophenyl)pyrazol-5-yl]methanimidate |
| SMILES | CCOC=Nc1c(C#N)cnn1-c1c(F)c(F)c(CC)c(F)c1F |
| InChI | InChI=1S/C15H12F4N4O/c1-3-9-10(16)12(18)14(13(19)11(9)17)23-15(21-7-24-4-2)8(5-20)6-22-23/h6-7H,3-4H2,1-2H3 |
| InChIKey | VPJXCYBWTPEDER-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 63.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.28 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|