C9H8N2O — CID 54404099
1-methyl-5-oxocyclohex-3-ene-1,3-dicarbonitrile (PubChem CID 54404099) has the molecular formula C9H8N2O and a molecular weight of 160.18 g/mol. Its IUPAC name is 1-methyl-5-oxocyclohex-3-ene-1,3-dicarbonitrile.
| Compound Name | 1-methyl-5-oxocyclohex-3-ene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 54404099 |
| Molecular Formula | C9H8N2O |
| Molecular Weight | 160.18 g/mol |
| Exact Mass | 160.06 |
| IUPAC Name | 1-methyl-5-oxocyclohex-3-ene-1,3-dicarbonitrile |
| SMILES | CC1(C#N)CC(=O)C=C(C#N)C1 |
| InChI | InChI=1S/C9H8N2O/c1-9(6-11)3-7(5-10)2-8(12)4-9/h2H,3-4H2,1H3 |
| InChIKey | VPLGWKUPINXBMH-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 64.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.18 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_cyano_E(1)', 'substructure': 'N/A'} |
|---|