About 4,5-dihydroxy-9,10-dioxoanthracene-2-carboxamide
4,5-dihydroxy-9,10-dioxoanthracene-2-carboxamide (PubChem CID 54404292) has the molecular formula C15H9NO5
and a molecular weight of 283.24 g/mol. Its IUPAC name is 4,5-dihydroxy-9,10-dioxoanthracene-2-carboxamide.
Molecular Properties
| Compound Name | 4,5-dihydroxy-9,10-dioxoanthracene-2-carboxamide |
| PubChem CID | 54404292 |
| Molecular Formula | C15H9NO5 |
| Molecular Weight | 283.24 g/mol |
| Exact Mass | 283.05 |
| IUPAC Name | 4,5-dihydroxy-9,10-dioxoanthracene-2-carboxamide |
| SMILES | NC(=O)c1cc(O)c2c(c1)C(=O)c1cccc(O)c1C2=O |
| InChI | InChI=1S/C15H9NO5/c16-15(21)6-4-8-12(10(18)5-6)14(20)11-7(13(8)19)2-1-3-9(11)17/h1-5,17-18H,(H2,16,21) |
| InChIKey | MKRBHPOMIKRWSA-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 117.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.24 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze 4,5-dihydroxy-9,10-dioxoanthracene-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dihydroxy-9,10-dioxoanthracene-2-carboxamide?
The IUPAC name of 4,5-dihydroxy-9,10-dioxoanthracene-2-carboxamide (CID 54404292) is 4,5-dihydroxy-9,10-dioxoanthracene-2-carboxamide.
What is the SMILES notation for 4,5-dihydroxy-9,10-dioxoanthracene-2-carboxamide?
The canonical SMILES for 4,5-dihydroxy-9,10-dioxoanthracene-2-carboxamide is NC(=O)c1cc(O)c2c(c1)C(=O)c1cccc(O)c1C2=O.
What is the InChIKey of 4,5-dihydroxy-9,10-dioxoanthracene-2-carboxamide?
The InChIKey is MKRBHPOMIKRWSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H9NO5/c16-15(21)6-4-8-12(10(18)5-6)14(20)11-7(13(8)19)2-1-3-9(11)17/h1-5,17-18H,(H2,16,21).
What are the key properties of 4,5-dihydroxy-9,10-dioxoanthracene-2-carboxamide?
4,5-dihydroxy-9,10-dioxoanthracene-2-carboxamide has a molecular weight of 283.24 g/mol, XLogP of 0.97, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dihydroxy-9,10-dioxoanthracene-2-carboxamide is sourced from PubChem (CID 54404292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).