but-2-enyl phosphono hydrogen phosphate

C4H10O7P2 — CID 54404583

IUPACbut-2-enyl phosphono hydrogen phosphate
SMILESCC=CCOP(=O)(O)OP(=O)(O)O
InChIInChI=1S/C4H10O7P2/c1-2-3-4-10-13(8,9)11-12(5,6)7/h2-3H,4H2,1H3,(H,8,9)(H2,5,6,7)
InChIKeyVPTVZDVITVNLTM-UHFFFAOYSA-N
MW232.06 g/mol
LogP0.79
Rot. Bonds5

About but-2-enyl phosphono hydrogen phosphate

but-2-enyl phosphono hydrogen phosphate (PubChem CID 54404583) has the molecular formula C4H10O7P2 and a molecular weight of 232.06 g/mol. Its IUPAC name is but-2-enyl phosphono hydrogen phosphate.

Molecular Properties

Compound Namebut-2-enyl phosphono hydrogen phosphate
PubChem CID54404583
Molecular FormulaC4H10O7P2
Molecular Weight232.06 g/mol
Exact Mass231.99
IUPAC Namebut-2-enyl phosphono hydrogen phosphate
SMILESCC=CCOP(=O)(O)OP(=O)(O)O
InChIInChI=1S/C4H10O7P2/c1-2-3-4-10-13(8,9)11-12(5,6)7/h2-3H,4H2,1H3,(H,8,9)(H2,5,6,7)
InChIKeyVPTVZDVITVNLTM-UHFFFAOYSA-N
XLogP0.79
TPSA113.29 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500232.06
LogP ≤ 50.79
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze but-2-enyl phosphono hydrogen phosphate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of but-2-enyl phosphono hydrogen phosphate?
The IUPAC name of but-2-enyl phosphono hydrogen phosphate (CID 54404583) is but-2-enyl phosphono hydrogen phosphate.
What is the SMILES notation for but-2-enyl phosphono hydrogen phosphate?
The canonical SMILES for but-2-enyl phosphono hydrogen phosphate is CC=CCOP(=O)(O)OP(=O)(O)O.
What is the InChIKey of but-2-enyl phosphono hydrogen phosphate?
The InChIKey is VPTVZDVITVNLTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10O7P2/c1-2-3-4-10-13(8,9)11-12(5,6)7/h2-3H,4H2,1H3,(H,8,9)(H2,5,6,7).
What are the key properties of but-2-enyl phosphono hydrogen phosphate?
but-2-enyl phosphono hydrogen phosphate has a molecular weight of 232.06 g/mol, XLogP of 0.79, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for but-2-enyl phosphono hydrogen phosphate is sourced from PubChem (CID 54404583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).