C13H8N4OS2 — CID 54404607
5-(4-isothiocyanato-3-methylphenyl)-3-(1,3-thiazol-4-yl)-1,2,4-oxadiazole (PubChem CID 54404607) has the molecular formula C13H8N4OS2 and a molecular weight of 300.37 g/mol. Its IUPAC name is 5-(4-isothiocyanato-3-methylphenyl)-3-(1,3-thiazol-4-yl)-1,2,4-oxadiazole.
| Compound Name | 5-(4-isothiocyanato-3-methylphenyl)-3-(1,3-thiazol-4-yl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 54404607 |
| Molecular Formula | C13H8N4OS2 |
| Molecular Weight | 300.37 g/mol |
| Exact Mass | 300.01 |
| IUPAC Name | 5-(4-isothiocyanato-3-methylphenyl)-3-(1,3-thiazol-4-yl)-1,2,4-oxadiazole |
| SMILES | Cc1cc(-c2nc(-c3cscn3)no2)ccc1N=C=S |
| InChI | InChI=1S/C13H8N4OS2/c1-8-4-9(2-3-10(8)14-6-19)13-16-12(17-18-13)11-5-20-7-15-11/h2-5,7H,1H3 |
| InChIKey | VPUDXYURAKHBGA-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 64.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.37 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|