C18H18F2N4O4 — CID 54405165
5-amino-1-cyclopropyl-6,8-difluoro-7-(4-nitrosopiperidin-1-yl)-4-oxoquinoline-3-carboxylic acid (PubChem CID 54405165) has the molecular formula C18H18F2N4O4 and a molecular weight of 392.36 g/mol. Its IUPAC name is 5-amino-1-cyclopropyl-6,8-difluoro-7-(4-nitrosopiperidin-1-yl)-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 5-amino-1-cyclopropyl-6,8-difluoro-7-(4-nitrosopiperidin-1-yl)-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 54405165 |
| Molecular Formula | C18H18F2N4O4 |
| Molecular Weight | 392.36 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | 5-amino-1-cyclopropyl-6,8-difluoro-7-(4-nitrosopiperidin-1-yl)-4-oxoquinoline-3-carboxylic acid |
| SMILES | Nc1c(F)c(N2CCC(N=O)CC2)c(F)c2c1c(=O)c(C(=O)O)cn2C1CC1 |
| InChI | InChI=1S/C18H18F2N4O4/c19-12-14(21)11-15(13(20)16(12)23-5-3-8(22-28)4-6-23)24(9-1-2-9)7-10(17(11)25)18(26)27/h7-9H,1-6,21H2,(H,26,27) |
| InChIKey | VQEKFPUGUYQOHM-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 117.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.36 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|